C28H54O5 — CID 131802145
[(2S)-1-hydroxy-3-(10-methylundecanoyloxy)propan-2-yl] 11-methyldodecanoate (PubChem CID 131802145) has the molecular formula C28H54O5 and a molecular weight of 470.74 g/mol. Its IUPAC name is [(2S)-1-hydroxy-3-(10-methylundecanoyloxy)propan-2-yl] 11-methyldodecanoate.
| Compound Name | [(2S)-1-hydroxy-3-(10-methylundecanoyloxy)propan-2-yl] 11-methyldodecanoate |
|---|---|
| PubChem CID | 131802145 |
| Molecular Formula | C28H54O5 |
| Molecular Weight | 470.74 g/mol |
| Exact Mass | 470.40 |
| IUPAC Name | [(2S)-1-hydroxy-3-(10-methylundecanoyloxy)propan-2-yl] 11-methyldodecanoate |
| SMILES | CC(C)CCCCCCCCCC(=O)O[C@@H](CO)COC(=O)CCCCCCCCC(C)C |
| InChI | InChI=1S/C28H54O5/c1-24(2)18-14-10-6-5-7-13-17-21-28(31)33-26(22-29)23-32-27(30)20-16-12-9-8-11-15-19-25(3)4/h24-26,29H,5-23H2,1-4H3/t26-/m0/s1 |
| InChIKey | MBYCWCISFMWOHU-SANMLTNESA-N |
| XLogP | 7.38 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.74 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|