2-(octa-4,5-dienoylamino)acetic acid

C10H15NO3 — CID 131802975

IUPAC2-(octa-4,5-dienoylamino)acetic acid
SMILESCCC=C=CCCC(=O)NCC(=O)O
InChIInChI=1S/C10H15NO3/c1-2-3-4-5-6-7-9(12)11-8-10(13)14/h3,5H,2,6-8H2,1H3,(H,11,12)(H,13,14)
InChIKeyLOPZOUPNQQOYPL-UHFFFAOYSA-N
MW197.23 g/mol
LogP1.09
Rot. Bonds6

About 2-(octa-4,5-dienoylamino)acetic acid

2-(octa-4,5-dienoylamino)acetic acid (PubChem CID 131802975) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is 2-(octa-4,5-dienoylamino)acetic acid.

Molecular Properties

Compound Name2-(octa-4,5-dienoylamino)acetic acid
PubChem CID131802975
Molecular FormulaC10H15NO3
Molecular Weight197.23 g/mol
Exact Mass197.11
IUPAC Name2-(octa-4,5-dienoylamino)acetic acid
SMILESCCC=C=CCCC(=O)NCC(=O)O
InChIInChI=1S/C10H15NO3/c1-2-3-4-5-6-7-9(12)11-8-10(13)14/h3,5H,2,6-8H2,1H3,(H,11,12)(H,13,14)
InChIKeyLOPZOUPNQQOYPL-UHFFFAOYSA-N
XLogP1.09
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500197.23
LogP ≤ 51.09
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(octa-4,5-dienoylamino)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(octa-4,5-dienoylamino)acetic acid?
The IUPAC name of 2-(octa-4,5-dienoylamino)acetic acid (CID 131802975) is 2-(octa-4,5-dienoylamino)acetic acid.
What is the SMILES notation for 2-(octa-4,5-dienoylamino)acetic acid?
The canonical SMILES for 2-(octa-4,5-dienoylamino)acetic acid is CCC=C=CCCC(=O)NCC(=O)O.
What is the InChIKey of 2-(octa-4,5-dienoylamino)acetic acid?
The InChIKey is LOPZOUPNQQOYPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO3/c1-2-3-4-5-6-7-9(12)11-8-10(13)14/h3,5H,2,6-8H2,1H3,(H,11,12)(H,13,14).
What are the key properties of 2-(octa-4,5-dienoylamino)acetic acid?
2-(octa-4,5-dienoylamino)acetic acid has a molecular weight of 197.23 g/mol, XLogP of 1.09, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(octa-4,5-dienoylamino)acetic acid is sourced from PubChem (CID 131802975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).