About 2-(octa-4,5-dienoylamino)acetic acid
2-(octa-4,5-dienoylamino)acetic acid (PubChem CID 131802975) has the molecular formula C10H15NO3
and a molecular weight of 197.23 g/mol. Its IUPAC name is 2-(octa-4,5-dienoylamino)acetic acid.
Molecular Properties
| Compound Name | 2-(octa-4,5-dienoylamino)acetic acid |
| PubChem CID | 131802975 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 2-(octa-4,5-dienoylamino)acetic acid |
| SMILES | CCC=C=CCCC(=O)NCC(=O)O |
| InChI | InChI=1S/C10H15NO3/c1-2-3-4-5-6-7-9(12)11-8-10(13)14/h3,5H,2,6-8H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | LOPZOUPNQQOYPL-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(octa-4,5-dienoylamino)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(octa-4,5-dienoylamino)acetic acid?
The IUPAC name of 2-(octa-4,5-dienoylamino)acetic acid (CID 131802975) is 2-(octa-4,5-dienoylamino)acetic acid.
What is the SMILES notation for 2-(octa-4,5-dienoylamino)acetic acid?
The canonical SMILES for 2-(octa-4,5-dienoylamino)acetic acid is CCC=C=CCCC(=O)NCC(=O)O.
What is the InChIKey of 2-(octa-4,5-dienoylamino)acetic acid?
The InChIKey is LOPZOUPNQQOYPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO3/c1-2-3-4-5-6-7-9(12)11-8-10(13)14/h3,5H,2,6-8H2,1H3,(H,11,12)(H,13,14).
What are the key properties of 2-(octa-4,5-dienoylamino)acetic acid?
2-(octa-4,5-dienoylamino)acetic acid has a molecular weight of 197.23 g/mol, XLogP of 1.09, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(octa-4,5-dienoylamino)acetic acid is sourced from PubChem (CID 131802975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).