C42H80O6 — CID 131805122
2,3-bis(10-methyldodecanoyloxy)propyl 10-methyldodecanoate (PubChem CID 131805122) has the molecular formula C42H80O6 and a molecular weight of 681.10 g/mol. Its IUPAC name is 2,3-bis(10-methyldodecanoyloxy)propyl 10-methyldodecanoate.
| Compound Name | 2,3-bis(10-methyldodecanoyloxy)propyl 10-methyldodecanoate |
|---|---|
| PubChem CID | 131805122 |
| Molecular Formula | C42H80O6 |
| Molecular Weight | 681.10 g/mol |
| Exact Mass | 680.60 |
| IUPAC Name | 2,3-bis(10-methyldodecanoyloxy)propyl 10-methyldodecanoate |
| SMILES | CCC(C)CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCC(C)CC |
| InChI | InChI=1S/C42H80O6/c1-7-36(4)28-22-16-10-13-19-25-31-40(43)46-34-39(48-42(45)33-27-21-15-12-18-24-30-38(6)9-3)35-47-41(44)32-26-20-14-11-17-23-29-37(5)8-2/h36-39H,7-35H2,1-6H3 |
| InChIKey | GFWMWWKYTDSRFA-UHFFFAOYSA-N |
| XLogP | 12.49 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.10 |
| LogP ≤ 5 | 12.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|