About 1-(diazomethyl)-1-methyl-2,3,4,5-tetraphenylsilole
1-(diazomethyl)-1-methyl-2,3,4,5-tetraphenylsilole (PubChem CID 13180862) has the molecular formula C30H24N2Si
and a molecular weight of 440.62 g/mol. Its IUPAC name is 1-(diazomethyl)-1-methyl-2,3,4,5-tetraphenylsilole.
Molecular Properties
| Compound Name | 1-(diazomethyl)-1-methyl-2,3,4,5-tetraphenylsilole |
| PubChem CID | 13180862 |
| Molecular Formula | C30H24N2Si |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 1-(diazomethyl)-1-methyl-2,3,4,5-tetraphenylsilole |
| SMILES | C[Si]1(C=[N+]=[N-])C(c2ccccc2)=C(c2ccccc2)C(c2ccccc2)=C1c1ccccc1 |
| InChI | InChI=1S/C30H24N2Si/c1-33(22-32-31)29(25-18-10-4-11-19-25)27(23-14-6-2-7-15-23)28(24-16-8-3-9-17-24)30(33)26-20-12-5-13-21-26/h2-22H,1H3 |
| InChIKey | KGYZGIGNBXOGDA-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-(diazomethyl)-1-methyl-2,3,4,5-tetraphenylsilole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(diazomethyl)-1-methyl-2,3,4,5-tetraphenylsilole?
The IUPAC name of 1-(diazomethyl)-1-methyl-2,3,4,5-tetraphenylsilole (CID 13180862) is 1-(diazomethyl)-1-methyl-2,3,4,5-tetraphenylsilole.
What is the SMILES notation for 1-(diazomethyl)-1-methyl-2,3,4,5-tetraphenylsilole?
The canonical SMILES for 1-(diazomethyl)-1-methyl-2,3,4,5-tetraphenylsilole is C[Si]1(C=[N+]=[N-])C(c2ccccc2)=C(c2ccccc2)C(c2ccccc2)=C1c1ccccc1.
What is the InChIKey of 1-(diazomethyl)-1-methyl-2,3,4,5-tetraphenylsilole?
The InChIKey is KGYZGIGNBXOGDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H24N2Si/c1-33(22-32-31)29(25-18-10-4-11-19-25)27(23-14-6-2-7-15-23)28(24-16-8-3-9-17-24)30(33)26-20-12-5-13-21-26/h2-22H,1H3.
What are the key properties of 1-(diazomethyl)-1-methyl-2,3,4,5-tetraphenylsilole?
1-(diazomethyl)-1-methyl-2,3,4,5-tetraphenylsilole has a molecular weight of 440.62 g/mol, XLogP of 7.22, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(diazomethyl)-1-methyl-2,3,4,5-tetraphenylsilole is sourced from PubChem (CID 13180862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).