About 1-ethyl-1-methoxy-2,3,4,5-tetraphenylsilole
1-ethyl-1-methoxy-2,3,4,5-tetraphenylsilole (PubChem CID 13180868) has the molecular formula C31H28OSi
and a molecular weight of 444.65 g/mol. Its IUPAC name is 1-ethyl-1-methoxy-2,3,4,5-tetraphenylsilole.
Molecular Properties
| Compound Name | 1-ethyl-1-methoxy-2,3,4,5-tetraphenylsilole |
| PubChem CID | 13180868 |
| Molecular Formula | C31H28OSi |
| Molecular Weight | 444.65 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 1-ethyl-1-methoxy-2,3,4,5-tetraphenylsilole |
| SMILES | CC[Si]1(OC)C(c2ccccc2)=C(c2ccccc2)C(c2ccccc2)=C1c1ccccc1 |
| InChI | InChI=1S/C31H28OSi/c1-3-33(32-2)30(26-20-12-6-13-21-26)28(24-16-8-4-9-17-24)29(25-18-10-5-11-19-25)31(33)27-22-14-7-15-23-27/h4-23H,3H2,1-2H3 |
| InChIKey | KQXBQPFXQBNAJG-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.65 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-1-methoxy-2,3,4,5-tetraphenylsilole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-1-methoxy-2,3,4,5-tetraphenylsilole?
The IUPAC name of 1-ethyl-1-methoxy-2,3,4,5-tetraphenylsilole (CID 13180868) is 1-ethyl-1-methoxy-2,3,4,5-tetraphenylsilole.
What is the SMILES notation for 1-ethyl-1-methoxy-2,3,4,5-tetraphenylsilole?
The canonical SMILES for 1-ethyl-1-methoxy-2,3,4,5-tetraphenylsilole is CC[Si]1(OC)C(c2ccccc2)=C(c2ccccc2)C(c2ccccc2)=C1c1ccccc1.
What is the InChIKey of 1-ethyl-1-methoxy-2,3,4,5-tetraphenylsilole?
The InChIKey is KQXBQPFXQBNAJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H28OSi/c1-3-33(32-2)30(26-20-12-6-13-21-26)28(24-16-8-4-9-17-24)29(25-18-10-5-11-19-25)31(33)27-22-14-7-15-23-27/h4-23H,3H2,1-2H3.
What are the key properties of 1-ethyl-1-methoxy-2,3,4,5-tetraphenylsilole?
1-ethyl-1-methoxy-2,3,4,5-tetraphenylsilole has a molecular weight of 444.65 g/mol, XLogP of 7.91, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-1-methoxy-2,3,4,5-tetraphenylsilole is sourced from PubChem (CID 13180868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).