C14H14O9 — CID 13181152
tetramethyl 7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3,5,6-tetracarboxylate (PubChem CID 13181152) has the molecular formula C14H14O9 and a molecular weight of 326.26 g/mol. Its IUPAC name is tetramethyl 7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3,5,6-tetracarboxylate.
| Compound Name | tetramethyl 7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3,5,6-tetracarboxylate |
|---|---|
| PubChem CID | 13181152 |
| Molecular Formula | C14H14O9 |
| Molecular Weight | 326.26 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | tetramethyl 7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3,5,6-tetracarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2OC1C(C(=O)OC)=C2C(=O)OC |
| InChI | InChI=1S/C14H14O9/c1-19-11(15)5-6(12(16)20-2)10-8(14(18)22-4)7(9(5)23-10)13(17)21-3/h9-10H,1-4H3 |
| InChIKey | RHMMABSZUVWWTP-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.26 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|