About 6-methyl-N-propylhepta-4,5-dien-1-amine
6-methyl-N-propylhepta-4,5-dien-1-amine (PubChem CID 13181238) has the molecular formula C11H21N
and a molecular weight of 167.30 g/mol. Its IUPAC name is 6-methyl-N-propylhepta-4,5-dien-1-amine.
Molecular Properties
| Compound Name | 6-methyl-N-propylhepta-4,5-dien-1-amine |
| PubChem CID | 13181238 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | 6-methyl-N-propylhepta-4,5-dien-1-amine |
| SMILES | CCCNCCCC=C=C(C)C |
| InChI | InChI=1S/C11H21N/c1-4-9-12-10-7-5-6-8-11(2)3/h6,12H,4-5,7,9-10H2,1-3H3 |
| InChIKey | ZQYOVCXUBVXLBC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-N-propylhepta-4,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-N-propylhepta-4,5-dien-1-amine?
The IUPAC name of 6-methyl-N-propylhepta-4,5-dien-1-amine (CID 13181238) is 6-methyl-N-propylhepta-4,5-dien-1-amine.
What is the SMILES notation for 6-methyl-N-propylhepta-4,5-dien-1-amine?
The canonical SMILES for 6-methyl-N-propylhepta-4,5-dien-1-amine is CCCNCCCC=C=C(C)C.
What is the InChIKey of 6-methyl-N-propylhepta-4,5-dien-1-amine?
The InChIKey is ZQYOVCXUBVXLBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N/c1-4-9-12-10-7-5-6-8-11(2)3/h6,12H,4-5,7,9-10H2,1-3H3.
What are the key properties of 6-methyl-N-propylhepta-4,5-dien-1-amine?
6-methyl-N-propylhepta-4,5-dien-1-amine has a molecular weight of 167.30 g/mol, XLogP of 2.89, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-N-propylhepta-4,5-dien-1-amine is sourced from PubChem (CID 13181238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).