About 6-methyl-2,3-dihydro-1,4-oxathiine-5-carbonyl azide
6-methyl-2,3-dihydro-1,4-oxathiine-5-carbonyl azide (PubChem CID 13181303) has the molecular formula C6H7N3O2S
and a molecular weight of 185.21 g/mol. Its IUPAC name is 6-methyl-2,3-dihydro-1,4-oxathiine-5-carbonyl azide.
Molecular Properties
| Compound Name | 6-methyl-2,3-dihydro-1,4-oxathiine-5-carbonyl azide |
| PubChem CID | 13181303 |
| Molecular Formula | C6H7N3O2S |
| Molecular Weight | 185.21 g/mol |
| Exact Mass | 185.03 |
| IUPAC Name | 6-methyl-2,3-dihydro-1,4-oxathiine-5-carbonyl azide |
| SMILES | CC1=C(C(=O)N=[N+]=[N-])SCCO1 |
| InChI | InChI=1S/C6H7N3O2S/c1-4-5(6(10)8-9-7)12-3-2-11-4/h2-3H2,1H3 |
| InChIKey | CKSVNUGGZFBYTI-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.21 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-2,3-dihydro-1,4-oxathiine-5-carbonyl azide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2,3-dihydro-1,4-oxathiine-5-carbonyl azide?
The IUPAC name of 6-methyl-2,3-dihydro-1,4-oxathiine-5-carbonyl azide (CID 13181303) is 6-methyl-2,3-dihydro-1,4-oxathiine-5-carbonyl azide.
What is the SMILES notation for 6-methyl-2,3-dihydro-1,4-oxathiine-5-carbonyl azide?
The canonical SMILES for 6-methyl-2,3-dihydro-1,4-oxathiine-5-carbonyl azide is CC1=C(C(=O)N=[N+]=[N-])SCCO1.
What is the InChIKey of 6-methyl-2,3-dihydro-1,4-oxathiine-5-carbonyl azide?
The InChIKey is CKSVNUGGZFBYTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O2S/c1-4-5(6(10)8-9-7)12-3-2-11-4/h2-3H2,1H3.
What are the key properties of 6-methyl-2,3-dihydro-1,4-oxathiine-5-carbonyl azide?
6-methyl-2,3-dihydro-1,4-oxathiine-5-carbonyl azide has a molecular weight of 185.21 g/mol, XLogP of 1.82, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2,3-dihydro-1,4-oxathiine-5-carbonyl azide is sourced from PubChem (CID 13181303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).