C24H18F3N3O2 — CID 13181503
(1R,3S,3aR,6aS)-5-phenyl-3-pyridin-2-yl-1-[4-(trifluoromethyl)phenyl]-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-4,6-dione (PubChem CID 13181503) has the molecular formula C24H18F3N3O2 and a molecular weight of 437.42 g/mol. Its IUPAC name is (1R,3S,3aR,6aS)-5-phenyl-3-pyridin-2-yl-1-[4-(trifluoromethyl)phenyl]-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-4,6-dione.
| Compound Name | (1R,3S,3aR,6aS)-5-phenyl-3-pyridin-2-yl-1-[4-(trifluoromethyl)phenyl]-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 13181503 |
| Molecular Formula | C24H18F3N3O2 |
| Molecular Weight | 437.42 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | (1R,3S,3aR,6aS)-5-phenyl-3-pyridin-2-yl-1-[4-(trifluoromethyl)phenyl]-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-4,6-dione |
| SMILES | O=C1[C@@H]2[C@H](C(=O)N1c1ccccc1)[C@H](c1ccc(C(F)(F)F)cc1)N[C@@H]2c1ccccn1 |
| InChI | InChI=1S/C24H18F3N3O2/c25-24(26,27)15-11-9-14(10-12-15)20-18-19(21(29-20)17-8-4-5-13-28-17)23(32)30(22(18)31)16-6-2-1-3-7-16/h1-13,18-21,29H/t18-,19+,20-,21+/m0/s1 |
| InChIKey | RXIWJMSPVAUHOH-JSXRDJHFSA-N |
| XLogP | 4.29 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.42 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|