6-[(Z)-hexadec-9-enoyl]oxyhexadecanoic acid

C32H60O4 — CID 131819635

IUPAC6-[(Z)-hexadec-9-enoyl]oxyhexadecanoic acid
SMILESCCCCCC/C=C\CCCCCCCC(=O)OC(CCCCCCCCCC)CCCCC(=O)O
InChIInChI=1S/C32H60O4/c1-3-5-7-9-11-13-14-15-16-17-19-21-23-29-32(35)36-30(27-24-25-28-31(33)34)26-22-20-18-12-10-8-6-4-2/h13-14,30H,3-12,15-29H2,1-2H3,(H,33,34)/b14-13-
InChIKeyXNSBDPOOLWLMSO-YPKPFQOOSA-N
MW508.83 g/mol
LogP10.33
Rot. Bonds28

About 6-[(Z)-hexadec-9-enoyl]oxyhexadecanoic acid

6-[(Z)-hexadec-9-enoyl]oxyhexadecanoic acid (PubChem CID 131819635) has the molecular formula C32H60O4 and a molecular weight of 508.83 g/mol. Its IUPAC name is 6-[(Z)-hexadec-9-enoyl]oxyhexadecanoic acid.

Molecular Properties

Compound Name6-[(Z)-hexadec-9-enoyl]oxyhexadecanoic acid
PubChem CID131819635
Molecular FormulaC32H60O4
Molecular Weight508.83 g/mol
Exact Mass508.45
IUPAC Name6-[(Z)-hexadec-9-enoyl]oxyhexadecanoic acid
SMILESCCCCCC/C=C\CCCCCCCC(=O)OC(CCCCCCCCCC)CCCCC(=O)O
InChIInChI=1S/C32H60O4/c1-3-5-7-9-11-13-14-15-16-17-19-21-23-29-32(35)36-30(27-24-25-28-31(33)34)26-22-20-18-12-10-8-6-4-2/h13-14,30H,3-12,15-29H2,1-2H3,(H,33,34)/b14-13-
InChIKeyXNSBDPOOLWLMSO-YPKPFQOOSA-N
XLogP10.33
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds28
Heavy Atoms36
Complexity—

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500508.83
LogP ≤ 510.33
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 6-[(Z)-hexadec-9-enoyl]oxyhexadecanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(Z)-9-heptadecanoyloxyhexacos-15-enoic acid
CID 138158627
6-[(Z)-tetracos-15-enoyl]oxydocosanoic acid
CID 134730265
14-[(Z)-docos-13-enoyl]oxytetracosanoic acid
CID 134726345
12-[(Z)-tetracos-15-enoyl]oxydocosanoic acid
CID 134743453
9-[(Z)-octadec-9-enoyl]oxydocosanoic acid
CID 134764498
7-[(Z)-heptadec-9-enoyl]oxytridecanoic acid
CID 138142268
9-[(Z)-hexadec-9-enoyl]oxydocosanoic acid
CID 134731283
13-[(Z)-heptadec-10-enoyl]oxytetracosanoic acid
CID 134749410
12-[(Z)-heptadec-10-enoyl]oxyoctadecanoic acid
CID 134770292
17-[(Z)-octadec-9-enoyl]oxytetracosanoic acid
CID 134759185
10-[(Z)-docos-13-enoyl]oxytetracosanoic acid
CID 134732553
6-[(Z)-hexadec-9-enoyl]oxytetracosanoic acid
CID 134743447

Frequently Asked Questions

What is the IUPAC name of 6-[(Z)-hexadec-9-enoyl]oxyhexadecanoic acid?
The IUPAC name of 6-[(Z)-hexadec-9-enoyl]oxyhexadecanoic acid (CID 131819635) is 6-[(Z)-hexadec-9-enoyl]oxyhexadecanoic acid.
What is the SMILES notation for 6-[(Z)-hexadec-9-enoyl]oxyhexadecanoic acid?
The canonical SMILES for 6-[(Z)-hexadec-9-enoyl]oxyhexadecanoic acid is CCCCCC/C=C\CCCCCCCC(=O)OC(CCCCCCCCCC)CCCCC(=O)O.
What is the InChIKey of 6-[(Z)-hexadec-9-enoyl]oxyhexadecanoic acid?
The InChIKey is XNSBDPOOLWLMSO-YPKPFQOOSA-N. The full InChI is InChI=1S/C32H60O4/c1-3-5-7-9-11-13-14-15-16-17-19-21-23-29-32(35)36-30(27-24-25-28-31(33)34)26-22-20-18-12-10-8-6-4-2/h13-14,30H,3-12,15-29H2,1-2H3,(H,33,34)/b14-13-.
What are the key properties of 6-[(Z)-hexadec-9-enoyl]oxyhexadecanoic acid?
6-[(Z)-hexadec-9-enoyl]oxyhexadecanoic acid has a molecular weight of 508.83 g/mol, XLogP of 10.33, 28 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(Z)-hexadec-9-enoyl]oxyhexadecanoic acid is sourced from PubChem (CID 131819635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).