C9H9ClN2O — CID 13182008
(2R,3R)-3-(4-chlorophenyl)aziridine-2-carboxamide (PubChem CID 13182008) has the molecular formula C9H9ClN2O and a molecular weight of 196.64 g/mol. Its IUPAC name is (2R,3R)-3-(4-chlorophenyl)aziridine-2-carboxamide.
| Compound Name | (2R,3R)-3-(4-chlorophenyl)aziridine-2-carboxamide |
|---|---|
| PubChem CID | 13182008 |
| Molecular Formula | C9H9ClN2O |
| Molecular Weight | 196.64 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | (2R,3R)-3-(4-chlorophenyl)aziridine-2-carboxamide |
| SMILES | NC(=O)[C@@H]1N[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H9ClN2O/c10-6-3-1-5(2-4-6)7-8(12-7)9(11)13/h1-4,7-8,12H,(H2,11,13)/t7-,8-/m1/s1 |
| InChIKey | GQKJPJGJYLDAPY-HTQZYQBOSA-N |
| XLogP | 0.84 |
| TPSA | 65.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.64 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|