C15H20O2S — CID 13182054
[(3E,5E)-nona-3,5-dien-2-yl]sulfonylbenzene (PubChem CID 13182054) has the molecular formula C15H20O2S and a molecular weight of 264.39 g/mol. Its IUPAC name is [(3E,5E)-nona-3,5-dien-2-yl]sulfonylbenzene.
| Compound Name | [(3E,5E)-nona-3,5-dien-2-yl]sulfonylbenzene |
|---|---|
| PubChem CID | 13182054 |
| Molecular Formula | C15H20O2S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | [(3E,5E)-nona-3,5-dien-2-yl]sulfonylbenzene |
| SMILES | CCC/C=C/C=C/C(C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H20O2S/c1-3-4-5-6-8-11-14(2)18(16,17)15-12-9-7-10-13-15/h5-14H,3-4H2,1-2H3/b6-5+,11-8+ |
| InChIKey | ZYGZNXYZOFCFEE-BXROQLSZSA-N |
| XLogP | 3.76 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|