C16H33O7P — CID 131821852
(2-hydroxy-3-phosphonooxypropyl) 10-methyldodecanoate (PubChem CID 131821852) has the molecular formula C16H33O7P and a molecular weight of 368.41 g/mol. Its IUPAC name is (2-hydroxy-3-phosphonooxypropyl) 10-methyldodecanoate.
| Compound Name | (2-hydroxy-3-phosphonooxypropyl) 10-methyldodecanoate |
|---|---|
| PubChem CID | 131821852 |
| Molecular Formula | C16H33O7P |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | (2-hydroxy-3-phosphonooxypropyl) 10-methyldodecanoate |
| SMILES | CCC(C)CCCCCCCCC(=O)OCC(O)COP(=O)(O)O |
| InChI | InChI=1S/C16H33O7P/c1-3-14(2)10-8-6-4-5-7-9-11-16(18)22-12-15(17)13-23-24(19,20)21/h14-15,17H,3-13H2,1-2H3,(H2,19,20,21) |
| InChIKey | JKRXHZXDGVADEJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|