C43H77O8P — CID 131821978
[(2R)-2-[(5Z,8Z,11Z)-icosa-5,8,11-trienoyl]oxy-3-phosphonooxypropyl] (Z)-icos-11-enoate (PubChem CID 131821978) has the molecular formula C43H77O8P and a molecular weight of 753.06 g/mol. Its IUPAC name is [(2R)-2-[(5Z,8Z,11Z)-icosa-5,8,11-trienoyl]oxy-3-phosphonooxypropyl] (Z)-icos-11-enoate.
| Compound Name | [(2R)-2-[(5Z,8Z,11Z)-icosa-5,8,11-trienoyl]oxy-3-phosphonooxypropyl] (Z)-icos-11-enoate |
|---|---|
| PubChem CID | 131821978 |
| Molecular Formula | C43H77O8P |
| Molecular Weight | 753.06 g/mol |
| Exact Mass | 752.54 |
| IUPAC Name | [(2R)-2-[(5Z,8Z,11Z)-icosa-5,8,11-trienoyl]oxy-3-phosphonooxypropyl] (Z)-icos-11-enoate |
| SMILES | CCCCCCCC/C=C\C/C=C\C/C=C\CCCC(=O)O[C@H](COC(=O)CCCCCCCCC/C=C\CCCCCCCC)COP(=O)(O)O |
| InChI | InChI=1S/C43H77O8P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-42(44)49-39-41(40-50-52(46,47)48)51-43(45)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,24,26,30,32,41H,3-16,21-23,25,27-29,31,33-40H2,1-2H3,(H2,46,47,48)/b19-17-,20-18-,26-24-,32-30-/t41-/m1/s1 |
| InChIKey | PXYNMSWUOOLSHY-QNXMOLMYSA-N |
| XLogP | 12.74 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.06 |
| LogP ≤ 5 | 12.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|