C29H57O8P — CID 131822456
[(2R)-2-(11-methyldodecanoyloxy)-3-phosphonooxypropyl] 11-methyldodecanoate (PubChem CID 131822456) has the molecular formula C29H57O8P and a molecular weight of 564.74 g/mol. Its IUPAC name is [(2R)-2-(11-methyldodecanoyloxy)-3-phosphonooxypropyl] 11-methyldodecanoate.
| Compound Name | [(2R)-2-(11-methyldodecanoyloxy)-3-phosphonooxypropyl] 11-methyldodecanoate |
|---|---|
| PubChem CID | 131822456 |
| Molecular Formula | C29H57O8P |
| Molecular Weight | 564.74 g/mol |
| Exact Mass | 564.38 |
| IUPAC Name | [(2R)-2-(11-methyldodecanoyloxy)-3-phosphonooxypropyl] 11-methyldodecanoate |
| SMILES | CC(C)CCCCCCCCCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCCCCCCCCC(C)C |
| InChI | InChI=1S/C29H57O8P/c1-25(2)19-15-11-7-5-9-13-17-21-28(30)35-23-27(24-36-38(32,33)34)37-29(31)22-18-14-10-6-8-12-16-20-26(3)4/h25-27H,5-24H2,1-4H3,(H2,32,33,34)/t27-/m1/s1 |
| InChIKey | YGYDEKKACWUNBW-HHHXNRCGSA-N |
| XLogP | 7.88 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.74 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|