C32H63O10P — CID 131823269
[(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-(10-methyldodecanoyloxy)propyl] 10-methyldodecanoate (PubChem CID 131823269) has the molecular formula C32H63O10P and a molecular weight of 638.82 g/mol. Its IUPAC name is [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-(10-methyldodecanoyloxy)propyl] 10-methyldodecanoate.
| Compound Name | [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-(10-methyldodecanoyloxy)propyl] 10-methyldodecanoate |
|---|---|
| PubChem CID | 131823269 |
| Molecular Formula | C32H63O10P |
| Molecular Weight | 638.82 g/mol |
| Exact Mass | 638.42 |
| IUPAC Name | [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-(10-methyldodecanoyloxy)propyl] 10-methyldodecanoate |
| SMILES | CCC(C)CCCCCCCCC(=O)OC[C@H](COP(=O)(O)OC[C@@H](O)CO)OC(=O)CCCCCCCCC(C)CC |
| InChI | InChI=1S/C32H63O10P/c1-5-27(3)19-15-11-7-9-13-17-21-31(35)39-25-30(26-41-43(37,38)40-24-29(34)23-33)42-32(36)22-18-14-10-8-12-16-20-28(4)6-2/h27-30,33-34H,5-26H2,1-4H3,(H,37,38)/t27?,28?,29-,30+/m0/s1 |
| InChIKey | SMKYVIMXFKVRDL-KPQOGYOCSA-N |
| XLogP | 7.26 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.82 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|