About diethyl (2E,3E)-2,3-di(pentylidene)butanedioate
diethyl (2E,3E)-2,3-di(pentylidene)butanedioate (PubChem CID 13182569) has the molecular formula C18H30O4
and a molecular weight of 310.43 g/mol. Its IUPAC name is diethyl (2E,3E)-2,3-di(pentylidene)butanedioate.
Molecular Properties
| Compound Name | diethyl (2E,3E)-2,3-di(pentylidene)butanedioate |
| PubChem CID | 13182569 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | diethyl (2E,3E)-2,3-di(pentylidene)butanedioate |
| SMILES | CCCC/C=C(C(=O)OCC)\C(=C/CCCC)C(=O)OCC |
| InChI | InChI=1S/C18H30O4/c1-5-9-11-13-15(17(19)21-7-3)16(14-12-10-6-2)18(20)22-8-4/h13-14H,5-12H2,1-4H3/b15-13+,16-14+ |
| InChIKey | RDPYLPQXTHSQJH-WXUKJITCSA-N |
| XLogP | 4.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze diethyl (2E,3E)-2,3-di(pentylidene)butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl (2E,3E)-2,3-di(pentylidene)butanedioate?
The IUPAC name of diethyl (2E,3E)-2,3-di(pentylidene)butanedioate (CID 13182569) is diethyl (2E,3E)-2,3-di(pentylidene)butanedioate.
What is the SMILES notation for diethyl (2E,3E)-2,3-di(pentylidene)butanedioate?
The canonical SMILES for diethyl (2E,3E)-2,3-di(pentylidene)butanedioate is CCCC/C=C(C(=O)OCC)\C(=C/CCCC)C(=O)OCC.
What is the InChIKey of diethyl (2E,3E)-2,3-di(pentylidene)butanedioate?
The InChIKey is RDPYLPQXTHSQJH-WXUKJITCSA-N. The full InChI is InChI=1S/C18H30O4/c1-5-9-11-13-15(17(19)21-7-3)16(14-12-10-6-2)18(20)22-8-4/h13-14H,5-12H2,1-4H3/b15-13+,16-14+.
What are the key properties of diethyl (2E,3E)-2,3-di(pentylidene)butanedioate?
diethyl (2E,3E)-2,3-di(pentylidene)butanedioate has a molecular weight of 310.43 g/mol, XLogP of 4.35, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl (2E,3E)-2,3-di(pentylidene)butanedioate is sourced from PubChem (CID 13182569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).