About 1,10-diazatricyclo[9.5.0.03,9]hexadeca-3(9),10-dien-2-one;hydrochloride
1,10-diazatricyclo[9.5.0.03,9]hexadeca-3(9),10-dien-2-one;hydrochloride (PubChem CID 13183100) has the molecular formula C14H21ClN2O
and a molecular weight of 268.79 g/mol. Its IUPAC name is 1,10-diazatricyclo[9.5.0.03,9]hexadeca-3(9),10-dien-2-one;hydrochloride.
Molecular Properties
| Compound Name | 1,10-diazatricyclo[9.5.0.03,9]hexadeca-3(9),10-dien-2-one;hydrochloride |
| PubChem CID | 13183100 |
| Molecular Formula | C14H21ClN2O |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 1,10-diazatricyclo[9.5.0.03,9]hexadeca-3(9),10-dien-2-one;hydrochloride |
| SMILES | Cl.O=c1c2c(nc3n1CCCCC3)CCCCC2 |
| InChI | InChI=1S/C14H20N2O.ClH/c17-14-11-7-3-1-4-8-12(11)15-13-9-5-2-6-10-16(13)14;/h1-10H2;1H |
| InChIKey | KGICXGWVBOLIGP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,10-diazatricyclo[9.5.0.03,9]hexadeca-3(9),10-dien-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,10-diazatricyclo[9.5.0.03,9]hexadeca-3(9),10-dien-2-one;hydrochloride?
The IUPAC name of 1,10-diazatricyclo[9.5.0.03,9]hexadeca-3(9),10-dien-2-one;hydrochloride (CID 13183100) is 1,10-diazatricyclo[9.5.0.03,9]hexadeca-3(9),10-dien-2-one;hydrochloride.
What is the SMILES notation for 1,10-diazatricyclo[9.5.0.03,9]hexadeca-3(9),10-dien-2-one;hydrochloride?
The canonical SMILES for 1,10-diazatricyclo[9.5.0.03,9]hexadeca-3(9),10-dien-2-one;hydrochloride is Cl.O=c1c2c(nc3n1CCCCC3)CCCCC2.
What is the InChIKey of 1,10-diazatricyclo[9.5.0.03,9]hexadeca-3(9),10-dien-2-one;hydrochloride?
The InChIKey is KGICXGWVBOLIGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O.ClH/c17-14-11-7-3-1-4-8-12(11)15-13-9-5-2-6-10-16(13)14;/h1-10H2;1H.
What are the key properties of 1,10-diazatricyclo[9.5.0.03,9]hexadeca-3(9),10-dien-2-one;hydrochloride?
1,10-diazatricyclo[9.5.0.03,9]hexadeca-3(9),10-dien-2-one;hydrochloride has a molecular weight of 268.79 g/mol, XLogP of 2.66, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,10-diazatricyclo[9.5.0.03,9]hexadeca-3(9),10-dien-2-one;hydrochloride is sourced from PubChem (CID 13183100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).