C31H32O14 — CID 131831436
8-(3,4-dihydroxyphenyl)-9-hydroxy-4-(4-hydroxy-3-methoxyphenyl)-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4,8,9,10-tetrahydro-3H-pyrano[2,3-h]chromen-2-one (PubChem CID 131831436) has the molecular formula C31H32O14 and a molecular weight of 628.58 g/mol. Its IUPAC name is 8-(3,4-dihydroxyphenyl)-9-hydroxy-4-(4-hydroxy-3-methoxyphenyl)-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4,8,9,10-tetrahydro-3H-pyrano[2,3-h]chromen-2-one.
| Compound Name | 8-(3,4-dihydroxyphenyl)-9-hydroxy-4-(4-hydroxy-3-methoxyphenyl)-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4,8,9,10-tetrahydro-3H-pyrano[2,3-h]chromen-2-one |
|---|---|
| PubChem CID | 131831436 |
| Molecular Formula | C31H32O14 |
| Molecular Weight | 628.58 g/mol |
| Exact Mass | 628.18 |
| IUPAC Name | 8-(3,4-dihydroxyphenyl)-9-hydroxy-4-(4-hydroxy-3-methoxyphenyl)-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4,8,9,10-tetrahydro-3H-pyrano[2,3-h]chromen-2-one |
| SMILES | COc1cc(C2CC(=O)Oc3c4c(cc(OC5OC(CO)C(O)C(O)C5O)c32)OC(c2ccc(O)c(O)c2)C(O)C4)ccc1O |
| InChI | InChI=1S/C31H32O14/c1-41-21-7-12(2-5-17(21)34)14-9-24(37)45-30-15-8-19(36)29(13-3-4-16(33)18(35)6-13)42-20(15)10-22(25(14)30)43-31-28(40)27(39)26(38)23(11-32)44-31/h2-7,10,14,19,23,26-29,31-36,38-40H,8-9,11H2,1H3 |
| InChIKey | DCHOZVQYOVRHPN-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 225.06 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.58 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|