C8H4F6LiNO — CID 13183303
lithium 1,1,1,3,3,3-hexafluoro-2-(2H-pyridin-1-ium-2-id-1-yl)propan-2-olate (PubChem CID 13183303) has the molecular formula C8H4F6LiNO and a molecular weight of 251.06 g/mol. Its IUPAC name is lithium 1,1,1,3,3,3-hexafluoro-2-(2H-pyridin-1-ium-2-id-1-yl)propan-2-olate.
| Compound Name | lithium 1,1,1,3,3,3-hexafluoro-2-(2H-pyridin-1-ium-2-id-1-yl)propan-2-olate |
|---|---|
| PubChem CID | 13183303 |
| Molecular Formula | C8H4F6LiNO |
| Molecular Weight | 251.06 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | lithium 1,1,1,3,3,3-hexafluoro-2-(2H-pyridin-1-ium-2-id-1-yl)propan-2-olate |
| SMILES | [Li+].[O-]C([n+]1[c-]cccc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H4F6NO.Li/c9-7(10,11)6(16,8(12,13)14)15-4-2-1-3-5-15;/h1-4H;/q-1;+1 |
| InChIKey | JKFNDZRPXSSUQE-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 26.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.06 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|