About (2E)-5-ethoxy-3,7-dimethylocta-2,6-dienal
(2E)-5-ethoxy-3,7-dimethylocta-2,6-dienal (PubChem CID 13183321) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is (2E)-5-ethoxy-3,7-dimethylocta-2,6-dienal.
Molecular Properties
| Compound Name | (2E)-5-ethoxy-3,7-dimethylocta-2,6-dienal |
| PubChem CID | 13183321 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | (2E)-5-ethoxy-3,7-dimethylocta-2,6-dienal |
| SMILES | CCOC(C=C(C)C)C/C(C)=C/C=O |
| InChI | InChI=1S/C12H20O2/c1-5-14-12(8-10(2)3)9-11(4)6-7-13/h6-8,12H,5,9H2,1-4H3/b11-6+ |
| InChIKey | UPYJESLNSUDUAR-IZZDOVSWSA-N |
| XLogP | 2.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-5-ethoxy-3,7-dimethylocta-2,6-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-5-ethoxy-3,7-dimethylocta-2,6-dienal?
The IUPAC name of (2E)-5-ethoxy-3,7-dimethylocta-2,6-dienal (CID 13183321) is (2E)-5-ethoxy-3,7-dimethylocta-2,6-dienal.
What is the SMILES notation for (2E)-5-ethoxy-3,7-dimethylocta-2,6-dienal?
The canonical SMILES for (2E)-5-ethoxy-3,7-dimethylocta-2,6-dienal is CCOC(C=C(C)C)C/C(C)=C/C=O.
What is the InChIKey of (2E)-5-ethoxy-3,7-dimethylocta-2,6-dienal?
The InChIKey is UPYJESLNSUDUAR-IZZDOVSWSA-N. The full InChI is InChI=1S/C12H20O2/c1-5-14-12(8-10(2)3)9-11(4)6-7-13/h6-8,12H,5,9H2,1-4H3/b11-6+.
What are the key properties of (2E)-5-ethoxy-3,7-dimethylocta-2,6-dienal?
(2E)-5-ethoxy-3,7-dimethylocta-2,6-dienal has a molecular weight of 196.29 g/mol, XLogP of 2.89, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-5-ethoxy-3,7-dimethylocta-2,6-dienal is sourced from PubChem (CID 13183321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).