C27H42N2O9S2 — CID 131833929
[(16S)-7-hydroxy-16-(hydroxymethyl)-8,8,10,12-tetramethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-5,9-dioxo-17-oxa-4-azabicyclo[14.1.0]heptadecan-11-yl] hydrogen sulfate (PubChem CID 131833929) has the molecular formula C27H42N2O9S2 and a molecular weight of 602.77 g/mol. Its IUPAC name is [(16S)-7-hydroxy-16-(hydroxymethyl)-8,8,10,12-tetramethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-5,9-dioxo-17-oxa-4-azabicyclo[14.1.0]heptadecan-11-yl] hydrogen sulfate.
| Compound Name | [(16S)-7-hydroxy-16-(hydroxymethyl)-8,8,10,12-tetramethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-5,9-dioxo-17-oxa-4-azabicyclo[14.1.0]heptadecan-11-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 131833929 |
| Molecular Formula | C27H42N2O9S2 |
| Molecular Weight | 602.77 g/mol |
| Exact Mass | 602.23 |
| IUPAC Name | [(16S)-7-hydroxy-16-(hydroxymethyl)-8,8,10,12-tetramethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-5,9-dioxo-17-oxa-4-azabicyclo[14.1.0]heptadecan-11-yl] hydrogen sulfate |
| SMILES | C/C(=C\c1csc(C)n1)C1CC2O[C@]2(CO)CCCC(C)C(OS(=O)(=O)O)C(C)C(=O)C(C)(C)C(O)CC(=O)N1 |
| InChI | InChI=1S/C27H42N2O9S2/c1-15-8-7-9-27(14-30)22(37-27)11-20(16(2)10-19-13-39-18(4)28-19)29-23(32)12-21(31)26(5,6)25(33)17(3)24(15)38-40(34,35)36/h10,13,15,17,20-22,24,30-31H,7-9,11-12,14H2,1-6H3,(H,29,32)(H,34,35,36)/b16-10+/t15?,17?,20?,21?,22?,24?,27-/m0/s1 |
| InChIKey | DQVKEVWJFPWPJI-IFZOTTCCSA-N |
| XLogP | 2.85 |
| TPSA | 175.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.77 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|