C16H20O8 — CID 131837489
6-(2-benzyl-3-oxopropoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 131837489) has the molecular formula C16H20O8 and a molecular weight of 340.33 g/mol. Its IUPAC name is 6-(2-benzyl-3-oxopropoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | 6-(2-benzyl-3-oxopropoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 131837489 |
| Molecular Formula | C16H20O8 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 6-(2-benzyl-3-oxopropoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | O=CC(COC1OC(C(=O)O)C(O)C(O)C1O)Cc1ccccc1 |
| InChI | InChI=1S/C16H20O8/c17-7-10(6-9-4-2-1-3-5-9)8-23-16-13(20)11(18)12(19)14(24-16)15(21)22/h1-5,7,10-14,16,18-20H,6,8H2,(H,21,22) |
| InChIKey | GSFWDAXCUBJKMY-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|