C17H22O8 — CID 131837545
6-(2-benzyl-3-oxobutoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 131837545) has the molecular formula C17H22O8 and a molecular weight of 354.36 g/mol. Its IUPAC name is 6-(2-benzyl-3-oxobutoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | 6-(2-benzyl-3-oxobutoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 131837545 |
| Molecular Formula | C17H22O8 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 6-(2-benzyl-3-oxobutoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | CC(=O)C(COC1OC(C(=O)O)C(O)C(O)C1O)Cc1ccccc1 |
| InChI | InChI=1S/C17H22O8/c1-9(18)11(7-10-5-3-2-4-6-10)8-24-17-14(21)12(19)13(20)15(25-17)16(22)23/h2-6,11-15,17,19-21H,7-8H2,1H3,(H,22,23) |
| InChIKey | GRCAFHGZBFPKMX-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |