C18H19NO4 — CID 131838489
3,5,6-trihydroxy-1-methyl-4,5-diphenylpiperidin-2-one (PubChem CID 131838489) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is 3,5,6-trihydroxy-1-methyl-4,5-diphenylpiperidin-2-one.
| Compound Name | 3,5,6-trihydroxy-1-methyl-4,5-diphenylpiperidin-2-one |
|---|---|
| PubChem CID | 131838489 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 3,5,6-trihydroxy-1-methyl-4,5-diphenylpiperidin-2-one |
| SMILES | CN1C(=O)C(O)C(c2ccccc2)C(O)(c2ccccc2)C1O |
| InChI | InChI=1S/C18H19NO4/c1-19-16(21)15(20)14(12-8-4-2-5-9-12)18(23,17(19)22)13-10-6-3-7-11-13/h2-11,14-15,17,20,22-23H,1H3 |
| InChIKey | CNACHALKENTRTL-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |