C11H7Cl2N3O2 — CID 131839676
methyl 2-(4,6-dichloropyrimidin-2-yl)pyridine-4-carboxylate (PubChem CID 131839676) has the molecular formula C11H7Cl2N3O2 and a molecular weight of 284.10 g/mol. Its IUPAC name is methyl 2-(4,6-dichloropyrimidin-2-yl)pyridine-4-carboxylate.
| Compound Name | methyl 2-(4,6-dichloropyrimidin-2-yl)pyridine-4-carboxylate |
|---|---|
| PubChem CID | 131839676 |
| Molecular Formula | C11H7Cl2N3O2 |
| Molecular Weight | 284.10 g/mol |
| Exact Mass | 282.99 |
| IUPAC Name | methyl 2-(4,6-dichloropyrimidin-2-yl)pyridine-4-carboxylate |
| SMILES | COC(=O)c1ccnc(-c2nc(Cl)cc(Cl)n2)c1 |
| InChI | InChI=1S/C11H7Cl2N3O2/c1-18-11(17)6-2-3-14-7(4-6)10-15-8(12)5-9(13)16-10/h2-5H,1H3 |
| InChIKey | ULWOLTMHBRTUOP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.10 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |