About 6-bromo-N,N-dimethyl-1,2-benzoxazol-3-amine
6-bromo-N,N-dimethyl-1,2-benzoxazol-3-amine (PubChem CID 131839714) has the molecular formula C9H9BrN2O
and a molecular weight of 241.09 g/mol. Its IUPAC name is 6-bromo-N,N-dimethyl-1,2-benzoxazol-3-amine.
Molecular Properties
| Compound Name | 6-bromo-N,N-dimethyl-1,2-benzoxazol-3-amine |
| PubChem CID | 131839714 |
| Molecular Formula | C9H9BrN2O |
| Molecular Weight | 241.09 g/mol |
| Exact Mass | 239.99 |
| IUPAC Name | 6-bromo-N,N-dimethyl-1,2-benzoxazol-3-amine |
| SMILES | CN(C)c1noc2cc(Br)ccc12 |
| InChI | InChI=1S/C9H9BrN2O/c1-12(2)9-7-4-3-6(10)5-8(7)13-11-9/h3-5H,1-2H3 |
| InChIKey | XRIYFWAEQYYXBP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.09 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromo-N,N-dimethyl-1,2-benzoxazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-N,N-dimethyl-1,2-benzoxazol-3-amine?
The IUPAC name of 6-bromo-N,N-dimethyl-1,2-benzoxazol-3-amine (CID 131839714) is 6-bromo-N,N-dimethyl-1,2-benzoxazol-3-amine.
What is the SMILES notation for 6-bromo-N,N-dimethyl-1,2-benzoxazol-3-amine?
The canonical SMILES for 6-bromo-N,N-dimethyl-1,2-benzoxazol-3-amine is CN(C)c1noc2cc(Br)ccc12.
What is the InChIKey of 6-bromo-N,N-dimethyl-1,2-benzoxazol-3-amine?
The InChIKey is XRIYFWAEQYYXBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrN2O/c1-12(2)9-7-4-3-6(10)5-8(7)13-11-9/h3-5H,1-2H3.
What are the key properties of 6-bromo-N,N-dimethyl-1,2-benzoxazol-3-amine?
6-bromo-N,N-dimethyl-1,2-benzoxazol-3-amine has a molecular weight of 241.09 g/mol, XLogP of 2.66, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-N,N-dimethyl-1,2-benzoxazol-3-amine is sourced from PubChem (CID 131839714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).