About 3-chloro-1H-imidazo[1,2-a]pyridin-7-one
3-chloro-1H-imidazo[1,2-a]pyridin-7-one (PubChem CID 131839727) has the molecular formula C7H5ClN2O
and a molecular weight of 168.58 g/mol. Its IUPAC name is 3-chloro-1H-imidazo[1,2-a]pyridin-7-one.
Molecular Properties
| Compound Name | 3-chloro-1H-imidazo[1,2-a]pyridin-7-one |
| PubChem CID | 131839727 |
| Molecular Formula | C7H5ClN2O |
| Molecular Weight | 168.58 g/mol |
| Exact Mass | 168.01 |
| IUPAC Name | 3-chloro-1H-imidazo[1,2-a]pyridin-7-one |
| SMILES | O=c1ccn2c(Cl)c[nH]c2c1 |
| InChI | InChI=1S/C7H5ClN2O/c8-6-4-9-7-3-5(11)1-2-10(6)7/h1-4,9H |
| InChIKey | LPQCDZSALGIEOR-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.58 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-chloro-1H-imidazo[1,2-a]pyridin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-1H-imidazo[1,2-a]pyridin-7-one?
The IUPAC name of 3-chloro-1H-imidazo[1,2-a]pyridin-7-one (CID 131839727) is 3-chloro-1H-imidazo[1,2-a]pyridin-7-one.
What is the SMILES notation for 3-chloro-1H-imidazo[1,2-a]pyridin-7-one?
The canonical SMILES for 3-chloro-1H-imidazo[1,2-a]pyridin-7-one is O=c1ccn2c(Cl)c[nH]c2c1.
What is the InChIKey of 3-chloro-1H-imidazo[1,2-a]pyridin-7-one?
The InChIKey is LPQCDZSALGIEOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClN2O/c8-6-4-9-7-3-5(11)1-2-10(6)7/h1-4,9H.
What are the key properties of 3-chloro-1H-imidazo[1,2-a]pyridin-7-one?
3-chloro-1H-imidazo[1,2-a]pyridin-7-one has a molecular weight of 168.58 g/mol, XLogP of 1.28, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-1H-imidazo[1,2-a]pyridin-7-one is sourced from PubChem (CID 131839727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).