C22H30O4 — CID 131840810
(4Z,7Z,10Z,13R,14E)-15-[(1R,5S)-5-ethyl-4-oxocyclopent-2-en-1-yl]-13-hydroxypentadeca-4,7,10,14-tetraenoic acid (PubChem CID 131840810) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is (4Z,7Z,10Z,13R,14E)-15-[(1R,5S)-5-ethyl-4-oxocyclopent-2-en-1-yl]-13-hydroxypentadeca-4,7,10,14-tetraenoic acid.
| Compound Name | (4Z,7Z,10Z,13R,14E)-15-[(1R,5S)-5-ethyl-4-oxocyclopent-2-en-1-yl]-13-hydroxypentadeca-4,7,10,14-tetraenoic acid |
|---|---|
| PubChem CID | 131840810 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | (4Z,7Z,10Z,13R,14E)-15-[(1R,5S)-5-ethyl-4-oxocyclopent-2-en-1-yl]-13-hydroxypentadeca-4,7,10,14-tetraenoic acid |
| SMILES | CC[C@@H]1C(=O)C=C[C@H]1/C=C/[C@H](O)C/C=C\C/C=C\C/C=C\CCC(=O)O |
| InChI | InChI=1S/C22H30O4/c1-2-20-18(15-17-21(20)24)14-16-19(23)12-10-8-6-4-3-5-7-9-11-13-22(25)26/h3-4,7-10,14-20,23H,2,5-6,11-13H2,1H3,(H,25,26)/b4-3-,9-7-,10-8-,16-14+/t18-,19-,20+/m1/s1 |
| InChIKey | VDNXNFTWHWSBCI-LIOIMTHUSA-N |
| XLogP | 4.39 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|