C22H34O6 — CID 131840873
(4Z,7Z,10Z,13R)-13-hydroxy-13-[(2R,4R,5S)-4-hydroxy-5-[(E,3R)-3-hydroxypent-1-enyl]oxolan-2-yl]trideca-4,7,10-trienoic acid (PubChem CID 131840873) has the molecular formula C22H34O6 and a molecular weight of 394.51 g/mol. Its IUPAC name is (4Z,7Z,10Z,13R)-13-hydroxy-13-[(2R,4R,5S)-4-hydroxy-5-[(E,3R)-3-hydroxypent-1-enyl]oxolan-2-yl]trideca-4,7,10-trienoic acid.
| Compound Name | (4Z,7Z,10Z,13R)-13-hydroxy-13-[(2R,4R,5S)-4-hydroxy-5-[(E,3R)-3-hydroxypent-1-enyl]oxolan-2-yl]trideca-4,7,10-trienoic acid |
|---|---|
| PubChem CID | 131840873 |
| Molecular Formula | C22H34O6 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | (4Z,7Z,10Z,13R)-13-hydroxy-13-[(2R,4R,5S)-4-hydroxy-5-[(E,3R)-3-hydroxypent-1-enyl]oxolan-2-yl]trideca-4,7,10-trienoic acid |
| SMILES | CC[C@@H](O)/C=C/[C@@H]1O[C@@H]([C@H](O)C/C=C\C/C=C\C/C=C\CCC(=O)O)C[C@H]1O |
| InChI | InChI=1S/C22H34O6/c1-2-17(23)14-15-20-19(25)16-21(28-20)18(24)12-10-8-6-4-3-5-7-9-11-13-22(26)27/h3-4,7-10,14-15,17-21,23-25H,2,5-6,11-13,16H2,1H3,(H,26,27)/b4-3-,9-7-,10-8-,15-14+/t17-,18-,19-,20+,21-/m1/s1 |
| InChIKey | FZIHUMXJLKHMGU-CKNDACAVSA-N |
| XLogP | 2.90 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|