C22H34O6 — CID 131841048
(4S)-4-hydroxy-4-[(2R,4R,5S)-4-hydroxy-5-[(1E,3R,5Z,8Z,11Z)-3-hydroxytetradeca-1,5,8,11-tetraenyl]oxolan-2-yl]butanoic acid (PubChem CID 131841048) has the molecular formula C22H34O6 and a molecular weight of 394.51 g/mol. Its IUPAC name is (4S)-4-hydroxy-4-[(2R,4R,5S)-4-hydroxy-5-[(1E,3R,5Z,8Z,11Z)-3-hydroxytetradeca-1,5,8,11-tetraenyl]oxolan-2-yl]butanoic acid.
| Compound Name | (4S)-4-hydroxy-4-[(2R,4R,5S)-4-hydroxy-5-[(1E,3R,5Z,8Z,11Z)-3-hydroxytetradeca-1,5,8,11-tetraenyl]oxolan-2-yl]butanoic acid |
|---|---|
| PubChem CID | 131841048 |
| Molecular Formula | C22H34O6 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | (4S)-4-hydroxy-4-[(2R,4R,5S)-4-hydroxy-5-[(1E,3R,5Z,8Z,11Z)-3-hydroxytetradeca-1,5,8,11-tetraenyl]oxolan-2-yl]butanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C[C@@H](O)/C=C/[C@@H]1O[C@@H]([C@@H](O)CCC(=O)O)C[C@H]1O |
| InChI | InChI=1S/C22H34O6/c1-2-3-4-5-6-7-8-9-10-11-17(23)12-14-20-19(25)16-21(28-20)18(24)13-15-22(26)27/h3-4,6-7,9-10,12,14,17-21,23-25H,2,5,8,11,13,15-16H2,1H3,(H,26,27)/b4-3-,7-6-,10-9-,14-12+/t17-,18+,19-,20+,21-/m1/s1 |
| InChIKey | JBGVKOJKQMZUTJ-XSLCDDRESA-N |
| XLogP | 2.90 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|