C40H76 — CID 131841492
(6S,10R,14E,18E,23R,27R)-2,6,10,14,19,23,27,31-octamethyldotriaconta-2,14,18-triene (PubChem CID 131841492) has the molecular formula C40H76 and a molecular weight of 557.05 g/mol. Its IUPAC name is (6S,10R,14E,18E,23R,27R)-2,6,10,14,19,23,27,31-octamethyldotriaconta-2,14,18-triene.
| Compound Name | (6S,10R,14E,18E,23R,27R)-2,6,10,14,19,23,27,31-octamethyldotriaconta-2,14,18-triene |
|---|---|
| PubChem CID | 131841492 |
| Molecular Formula | C40H76 |
| Molecular Weight | 557.05 g/mol |
| Exact Mass | 556.59 |
| IUPAC Name | (6S,10R,14E,18E,23R,27R)-2,6,10,14,19,23,27,31-octamethyldotriaconta-2,14,18-triene |
| SMILES | CC(C)=CCC[C@@H](C)CCC[C@@H](C)CCC/C(C)=C/CC/C=C(\C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C40H76/c1-33(2)19-13-23-37(7)27-17-31-39(9)29-15-25-35(5)21-11-12-22-36(6)26-16-30-40(10)32-18-28-38(8)24-14-20-34(3)4/h19,21-22,34,37-40H,11-18,20,23-32H2,1-10H3/b35-21+,36-22+/t37-,38-,39+,40+/m1/s1 |
| InChIKey | YFTFJUGGUKHGMJ-PQPPKSKMSA-N |
| XLogP | 14.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 26 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.05 |
| LogP ≤ 5 | 14.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|