C14H11F4O+ — CID 13184171
methyl-(3,4,5,6-tetrafluoro-8-methyl-9-tricyclo[6.3.1.02,7]dodeca-2(7),3,5,10-tetraenylidene)oxidanium (PubChem CID 13184171) has the molecular formula C14H11F4O+ and a molecular weight of 271.23 g/mol. Its IUPAC name is methyl-(3,4,5,6-tetrafluoro-8-methyl-9-tricyclo[6.3.1.02,7]dodeca-2(7),3,5,10-tetraenylidene)oxidanium.
| Compound Name | methyl-(3,4,5,6-tetrafluoro-8-methyl-9-tricyclo[6.3.1.02,7]dodeca-2(7),3,5,10-tetraenylidene)oxidanium |
|---|---|
| PubChem CID | 13184171 |
| Molecular Formula | C14H11F4O+ |
| Molecular Weight | 271.23 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | methyl-(3,4,5,6-tetrafluoro-8-methyl-9-tricyclo[6.3.1.02,7]dodeca-2(7),3,5,10-tetraenylidene)oxidanium |
| SMILES | C/[O+]=C1\C=CC2CC1(C)c1c(F)c(F)c(F)c(F)c12 |
| InChI | InChI=1S/C14H11F4O/c1-14-5-6(3-4-7(14)19-2)8-9(14)11(16)13(18)12(17)10(8)15/h3-4,6H,5H2,1-2H3/q+1 |
| InChIKey | LNLPESIVSPLAND-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 11.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.23 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|