C11H15KOS2 — CID 131841816
potassium [(1R,2S,6S,7R)-8-tricyclo[5.2.1.02,6]decanyl]oxymethanedithioate (PubChem CID 131841816) has the molecular formula C11H15KOS2 and a molecular weight of 266.47 g/mol. Its IUPAC name is potassium [(1R,2S,6S,7R)-8-tricyclo[5.2.1.02,6]decanyl]oxymethanedithioate.
| Compound Name | potassium [(1R,2S,6S,7R)-8-tricyclo[5.2.1.02,6]decanyl]oxymethanedithioate |
|---|---|
| PubChem CID | 131841816 |
| Molecular Formula | C11H15KOS2 |
| Molecular Weight | 266.47 g/mol |
| Exact Mass | 266.02 |
| IUPAC Name | potassium [(1R,2S,6S,7R)-8-tricyclo[5.2.1.02,6]decanyl]oxymethanedithioate |
| SMILES | S=C([S-])OC1C[C@H]2C[C@@H]1[C@H]1CCC[C@@H]21.[K+] |
| InChI | InChI=1S/C11H16OS2.K/c13-11(14)12-10-5-6-4-9(10)8-3-1-2-7(6)8;/h6-10H,1-5H2,(H,13,14);/q;+1/p-1/t6-,7+,8+,9-,10?;/m1./s1 |
| InChIKey | IGULCCCBGBDZKQ-IBUKJIQJSA-M |
| XLogP | -0.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.47 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|