About (1S)-1-(2,3-dichlorophenyl)ethanamine;hydrochloride
(1S)-1-(2,3-dichlorophenyl)ethanamine;hydrochloride (PubChem CID 131841891) has the molecular formula C8H10Cl3N
and a molecular weight of 226.53 g/mol. Its IUPAC name is (1S)-1-(2,3-dichlorophenyl)ethanamine;hydrochloride.
Molecular Properties
| Compound Name | (1S)-1-(2,3-dichlorophenyl)ethanamine;hydrochloride |
| PubChem CID | 131841891 |
| Molecular Formula | C8H10Cl3N |
| Molecular Weight | 226.53 g/mol |
| Exact Mass | 224.99 |
| IUPAC Name | (1S)-1-(2,3-dichlorophenyl)ethanamine;hydrochloride |
| SMILES | C[C@H](N)c1cccc(Cl)c1Cl.Cl |
| InChI | InChI=1S/C8H9Cl2N.ClH/c1-5(11)6-3-2-4-7(9)8(6)10;/h2-5H,11H2,1H3;1H/t5-;/m0./s1 |
| InChIKey | FQTXPVLCCDQRHY-JEDNCBNOSA-N |
| XLogP | 3.43 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.53 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1S)-1-(2,3-dichlorophenyl)ethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-(2,3-dichlorophenyl)ethanamine;hydrochloride?
The IUPAC name of (1S)-1-(2,3-dichlorophenyl)ethanamine;hydrochloride (CID 131841891) is (1S)-1-(2,3-dichlorophenyl)ethanamine;hydrochloride.
What is the SMILES notation for (1S)-1-(2,3-dichlorophenyl)ethanamine;hydrochloride?
The canonical SMILES for (1S)-1-(2,3-dichlorophenyl)ethanamine;hydrochloride is C[C@H](N)c1cccc(Cl)c1Cl.Cl.
What is the InChIKey of (1S)-1-(2,3-dichlorophenyl)ethanamine;hydrochloride?
The InChIKey is FQTXPVLCCDQRHY-JEDNCBNOSA-N. The full InChI is InChI=1S/C8H9Cl2N.ClH/c1-5(11)6-3-2-4-7(9)8(6)10;/h2-5H,11H2,1H3;1H/t5-;/m0./s1.
What are the key properties of (1S)-1-(2,3-dichlorophenyl)ethanamine;hydrochloride?
(1S)-1-(2,3-dichlorophenyl)ethanamine;hydrochloride has a molecular weight of 226.53 g/mol, XLogP of 3.43, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-(2,3-dichlorophenyl)ethanamine;hydrochloride is sourced from PubChem (CID 131841891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).