About 6-O-ethyl 1-O-methyl 2-methylidenehexanedioate
6-O-ethyl 1-O-methyl 2-methylidenehexanedioate (PubChem CID 131842712) has the molecular formula C10H16O4
and a molecular weight of 200.23 g/mol. Its IUPAC name is 6-O-ethyl 1-O-methyl 2-methylidenehexanedioate.
Molecular Properties
| Compound Name | 6-O-ethyl 1-O-methyl 2-methylidenehexanedioate |
| PubChem CID | 131842712 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 6-O-ethyl 1-O-methyl 2-methylidenehexanedioate |
| SMILES | C=C(CCCC(=O)OCC)C(=O)OC |
| InChI | InChI=1S/C10H16O4/c1-4-14-9(11)7-5-6-8(2)10(12)13-3/h2,4-7H2,1,3H3 |
| InChIKey | UEOWZDMIWQDAAA-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 6-O-ethyl 1-O-methyl 2-methylidenehexanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-O-ethyl 1-O-methyl 2-methylidenehexanedioate?
The IUPAC name of 6-O-ethyl 1-O-methyl 2-methylidenehexanedioate (CID 131842712) is 6-O-ethyl 1-O-methyl 2-methylidenehexanedioate.
What is the SMILES notation for 6-O-ethyl 1-O-methyl 2-methylidenehexanedioate?
The canonical SMILES for 6-O-ethyl 1-O-methyl 2-methylidenehexanedioate is C=C(CCCC(=O)OCC)C(=O)OC.
What is the InChIKey of 6-O-ethyl 1-O-methyl 2-methylidenehexanedioate?
The InChIKey is UEOWZDMIWQDAAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O4/c1-4-14-9(11)7-5-6-8(2)10(12)13-3/h2,4-7H2,1,3H3.
What are the key properties of 6-O-ethyl 1-O-methyl 2-methylidenehexanedioate?
6-O-ethyl 1-O-methyl 2-methylidenehexanedioate has a molecular weight of 200.23 g/mol, XLogP of 1.45, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-O-ethyl 1-O-methyl 2-methylidenehexanedioate is sourced from PubChem (CID 131842712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).