C12H18F2O3 — CID 131843890
(2Z,5Z)-4,4-difluoro-7-(oxan-2-yloxy)hepta-2,5-dien-1-ol (PubChem CID 131843890) has the molecular formula C12H18F2O3 and a molecular weight of 248.27 g/mol. Its IUPAC name is (2Z,5Z)-4,4-difluoro-7-(oxan-2-yloxy)hepta-2,5-dien-1-ol.
| Compound Name | (2Z,5Z)-4,4-difluoro-7-(oxan-2-yloxy)hepta-2,5-dien-1-ol |
|---|---|
| PubChem CID | 131843890 |
| Molecular Formula | C12H18F2O3 |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | (2Z,5Z)-4,4-difluoro-7-(oxan-2-yloxy)hepta-2,5-dien-1-ol |
| SMILES | OC/C=C\C(F)(F)/C=C\COC1CCCCO1 |
| InChI | InChI=1S/C12H18F2O3/c13-12(14,6-3-8-15)7-4-10-17-11-5-1-2-9-16-11/h3-4,6-7,11,15H,1-2,5,8-10H2/b6-3-,7-4- |
| InChIKey | DZDPSJRHOZOYED-VKOMYYDGSA-N |
| XLogP | 2.27 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|