About (2R,5R)-4-butyl-2,5-dimethylmorpholine
(2R,5R)-4-butyl-2,5-dimethylmorpholine (PubChem CID 131844399) has the molecular formula C10H21NO
and a molecular weight of 171.28 g/mol. Its IUPAC name is (2R,5R)-4-butyl-2,5-dimethylmorpholine.
Molecular Properties
| Compound Name | (2R,5R)-4-butyl-2,5-dimethylmorpholine |
| PubChem CID | 131844399 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | (2R,5R)-4-butyl-2,5-dimethylmorpholine |
| SMILES | CCCCN1C[C@@H](C)OC[C@H]1C |
| InChI | InChI=1S/C10H21NO/c1-4-5-6-11-7-10(3)12-8-9(11)2/h9-10H,4-8H2,1-3H3/t9-,10-/m1/s1 |
| InChIKey | BRYLIXFBAVZYCU-NXEZZACHSA-N |
| XLogP | 1.90 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R,5R)-4-butyl-2,5-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5R)-4-butyl-2,5-dimethylmorpholine?
The IUPAC name of (2R,5R)-4-butyl-2,5-dimethylmorpholine (CID 131844399) is (2R,5R)-4-butyl-2,5-dimethylmorpholine.
What is the SMILES notation for (2R,5R)-4-butyl-2,5-dimethylmorpholine?
The canonical SMILES for (2R,5R)-4-butyl-2,5-dimethylmorpholine is CCCCN1C[C@@H](C)OC[C@H]1C.
What is the InChIKey of (2R,5R)-4-butyl-2,5-dimethylmorpholine?
The InChIKey is BRYLIXFBAVZYCU-NXEZZACHSA-N. The full InChI is InChI=1S/C10H21NO/c1-4-5-6-11-7-10(3)12-8-9(11)2/h9-10H,4-8H2,1-3H3/t9-,10-/m1/s1.
What are the key properties of (2R,5R)-4-butyl-2,5-dimethylmorpholine?
(2R,5R)-4-butyl-2,5-dimethylmorpholine has a molecular weight of 171.28 g/mol, XLogP of 1.90, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5R)-4-butyl-2,5-dimethylmorpholine is sourced from PubChem (CID 131844399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).