C14H16Cl2N2O4 — CID 131844426
N-[4-(butanoylamino)-2,5-dichloro-3,6-dioxocyclohexa-1,4-dien-1-yl]butanamide (PubChem CID 131844426) has the molecular formula C14H16Cl2N2O4 and a molecular weight of 347.20 g/mol. Its IUPAC name is N-[4-(butanoylamino)-2,5-dichloro-3,6-dioxocyclohexa-1,4-dien-1-yl]butanamide.
| Compound Name | N-[4-(butanoylamino)-2,5-dichloro-3,6-dioxocyclohexa-1,4-dien-1-yl]butanamide |
|---|---|
| PubChem CID | 131844426 |
| Molecular Formula | C14H16Cl2N2O4 |
| Molecular Weight | 347.20 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | N-[4-(butanoylamino)-2,5-dichloro-3,6-dioxocyclohexa-1,4-dien-1-yl]butanamide |
| SMILES | CCCC(=O)NC1=C(Cl)C(=O)C(NC(=O)CCC)=C(Cl)C1=O |
| InChI | InChI=1S/C14H16Cl2N2O4/c1-3-5-7(19)17-11-9(15)14(22)12(10(16)13(11)21)18-8(20)6-4-2/h3-6H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | RCDDYOVHUCQAMN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.20 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|