C9H17NO3 — CID 131844507
ethyl (2S,4R)-4-(2-hydroxyethyl)pyrrolidine-2-carboxylate (PubChem CID 131844507) has the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. Its IUPAC name is ethyl (2S,4R)-4-(2-hydroxyethyl)pyrrolidine-2-carboxylate.
| Compound Name | ethyl (2S,4R)-4-(2-hydroxyethyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 131844507 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | ethyl (2S,4R)-4-(2-hydroxyethyl)pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@H](CCO)CN1 |
| InChI | InChI=1S/C9H17NO3/c1-2-13-9(12)8-5-7(3-4-11)6-10-8/h7-8,10-11H,2-6H2,1H3/t7-,8-/m0/s1 |
| InChIKey | YJZILJVMRVFMOA-YUMQZZPRSA-N |
| XLogP | -0.09 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |