About (2S,4R)-2-tert-butyl-4-propan-2-yl-1,3-oxathiolan-5-one
(2S,4R)-2-tert-butyl-4-propan-2-yl-1,3-oxathiolan-5-one (PubChem CID 131844963) has the molecular formula C10H18O2S
and a molecular weight of 202.32 g/mol. Its IUPAC name is (2S,4R)-2-tert-butyl-4-propan-2-yl-1,3-oxathiolan-5-one.
Molecular Properties
| Compound Name | (2S,4R)-2-tert-butyl-4-propan-2-yl-1,3-oxathiolan-5-one |
| PubChem CID | 131844963 |
| Molecular Formula | C10H18O2S |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | (2S,4R)-2-tert-butyl-4-propan-2-yl-1,3-oxathiolan-5-one |
| SMILES | CC(C)[C@H]1S[C@@H](C(C)(C)C)OC1=O |
| InChI | InChI=1S/C10H18O2S/c1-6(2)7-8(11)12-9(13-7)10(3,4)5/h6-7,9H,1-5H3/t7-,9+/m1/s1 |
| InChIKey | SRPULWXIDSQXLT-APPZFPTMSA-N |
| XLogP | 2.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S,4R)-2-tert-butyl-4-propan-2-yl-1,3-oxathiolan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4R)-2-tert-butyl-4-propan-2-yl-1,3-oxathiolan-5-one?
The IUPAC name of (2S,4R)-2-tert-butyl-4-propan-2-yl-1,3-oxathiolan-5-one (CID 131844963) is (2S,4R)-2-tert-butyl-4-propan-2-yl-1,3-oxathiolan-5-one.
What is the SMILES notation for (2S,4R)-2-tert-butyl-4-propan-2-yl-1,3-oxathiolan-5-one?
The canonical SMILES for (2S,4R)-2-tert-butyl-4-propan-2-yl-1,3-oxathiolan-5-one is CC(C)[C@H]1S[C@@H](C(C)(C)C)OC1=O.
What is the InChIKey of (2S,4R)-2-tert-butyl-4-propan-2-yl-1,3-oxathiolan-5-one?
The InChIKey is SRPULWXIDSQXLT-APPZFPTMSA-N. The full InChI is InChI=1S/C10H18O2S/c1-6(2)7-8(11)12-9(13-7)10(3,4)5/h6-7,9H,1-5H3/t7-,9+/m1/s1.
What are the key properties of (2S,4R)-2-tert-butyl-4-propan-2-yl-1,3-oxathiolan-5-one?
(2S,4R)-2-tert-butyl-4-propan-2-yl-1,3-oxathiolan-5-one has a molecular weight of 202.32 g/mol, XLogP of 2.67, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4R)-2-tert-butyl-4-propan-2-yl-1,3-oxathiolan-5-one is sourced from PubChem (CID 131844963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).