About 2-fluoro-1-[(3S,4S,5R)-5-hydroxy-4-methyloxolan-3-yl]ethanone
2-fluoro-1-[(3S,4S,5R)-5-hydroxy-4-methyloxolan-3-yl]ethanone (PubChem CID 131845419) has the molecular formula C7H11FO3
and a molecular weight of 162.16 g/mol. Its IUPAC name is 2-fluoro-1-[(3S,4S,5R)-5-hydroxy-4-methyloxolan-3-yl]ethanone.
Molecular Properties
| Compound Name | 2-fluoro-1-[(3S,4S,5R)-5-hydroxy-4-methyloxolan-3-yl]ethanone |
| PubChem CID | 131845419 |
| Molecular Formula | C7H11FO3 |
| Molecular Weight | 162.16 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | 2-fluoro-1-[(3S,4S,5R)-5-hydroxy-4-methyloxolan-3-yl]ethanone |
| SMILES | C[C@@H]1[C@H](O)OC[C@H]1C(=O)CF |
| InChI | InChI=1S/C7H11FO3/c1-4-5(6(9)2-8)3-11-7(4)10/h4-5,7,10H,2-3H2,1H3/t4-,5+,7+/m0/s1 |
| InChIKey | IMPPJJOYCISPLH-HBPOCXIASA-N |
| XLogP | 0.13 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.16 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-fluoro-1-[(3S,4S,5R)-5-hydroxy-4-methyloxolan-3-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-1-[(3S,4S,5R)-5-hydroxy-4-methyloxolan-3-yl]ethanone?
The IUPAC name of 2-fluoro-1-[(3S,4S,5R)-5-hydroxy-4-methyloxolan-3-yl]ethanone (CID 131845419) is 2-fluoro-1-[(3S,4S,5R)-5-hydroxy-4-methyloxolan-3-yl]ethanone.
What is the SMILES notation for 2-fluoro-1-[(3S,4S,5R)-5-hydroxy-4-methyloxolan-3-yl]ethanone?
The canonical SMILES for 2-fluoro-1-[(3S,4S,5R)-5-hydroxy-4-methyloxolan-3-yl]ethanone is C[C@@H]1[C@H](O)OC[C@H]1C(=O)CF.
What is the InChIKey of 2-fluoro-1-[(3S,4S,5R)-5-hydroxy-4-methyloxolan-3-yl]ethanone?
The InChIKey is IMPPJJOYCISPLH-HBPOCXIASA-N. The full InChI is InChI=1S/C7H11FO3/c1-4-5(6(9)2-8)3-11-7(4)10/h4-5,7,10H,2-3H2,1H3/t4-,5+,7+/m0/s1.
What are the key properties of 2-fluoro-1-[(3S,4S,5R)-5-hydroxy-4-methyloxolan-3-yl]ethanone?
2-fluoro-1-[(3S,4S,5R)-5-hydroxy-4-methyloxolan-3-yl]ethanone has a molecular weight of 162.16 g/mol, XLogP of 0.13, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-1-[(3S,4S,5R)-5-hydroxy-4-methyloxolan-3-yl]ethanone is sourced from PubChem (CID 131845419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).