About 1-(benzenecarbonothioyl)-3,3-diethyl-1-methylurea
1-(benzenecarbonothioyl)-3,3-diethyl-1-methylurea (PubChem CID 13184586) has the molecular formula C13H18N2OS
and a molecular weight of 250.37 g/mol. Its IUPAC name is 1-(benzenecarbonothioyl)-3,3-diethyl-1-methylurea.
Molecular Properties
| Compound Name | 1-(benzenecarbonothioyl)-3,3-diethyl-1-methylurea |
| PubChem CID | 13184586 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 1-(benzenecarbonothioyl)-3,3-diethyl-1-methylurea |
| SMILES | CCN(CC)C(=O)N(C)C(=S)c1ccccc1 |
| InChI | InChI=1S/C13H18N2OS/c1-4-15(5-2)13(16)14(3)12(17)11-9-7-6-8-10-11/h6-10H,4-5H2,1-3H3 |
| InChIKey | WFTABQBZNHQTJW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(benzenecarbonothioyl)-3,3-diethyl-1-methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(benzenecarbonothioyl)-3,3-diethyl-1-methylurea?
The IUPAC name of 1-(benzenecarbonothioyl)-3,3-diethyl-1-methylurea (CID 13184586) is 1-(benzenecarbonothioyl)-3,3-diethyl-1-methylurea.
What is the SMILES notation for 1-(benzenecarbonothioyl)-3,3-diethyl-1-methylurea?
The canonical SMILES for 1-(benzenecarbonothioyl)-3,3-diethyl-1-methylurea is CCN(CC)C(=O)N(C)C(=S)c1ccccc1.
What is the InChIKey of 1-(benzenecarbonothioyl)-3,3-diethyl-1-methylurea?
The InChIKey is WFTABQBZNHQTJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2OS/c1-4-15(5-2)13(16)14(3)12(17)11-9-7-6-8-10-11/h6-10H,4-5H2,1-3H3.
What are the key properties of 1-(benzenecarbonothioyl)-3,3-diethyl-1-methylurea?
1-(benzenecarbonothioyl)-3,3-diethyl-1-methylurea has a molecular weight of 250.37 g/mol, XLogP of 2.76, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(benzenecarbonothioyl)-3,3-diethyl-1-methylurea is sourced from PubChem (CID 13184586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).