C11H14O3S — CID 131846524
(2S,3S)-2-(benzenesulfonyl)-3-propyloxirane (PubChem CID 131846524) has the molecular formula C11H14O3S and a molecular weight of 226.30 g/mol. Its IUPAC name is (2S,3S)-2-(benzenesulfonyl)-3-propyloxirane.
| Compound Name | (2S,3S)-2-(benzenesulfonyl)-3-propyloxirane |
|---|---|
| PubChem CID | 131846524 |
| Molecular Formula | C11H14O3S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | (2S,3S)-2-(benzenesulfonyl)-3-propyloxirane |
| SMILES | CCC[C@@H]1O[C@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C11H14O3S/c1-2-6-10-11(14-10)15(12,13)9-7-4-3-5-8-9/h3-5,7-8,10-11H,2,6H2,1H3/t10-,11-/m0/s1 |
| InChIKey | HHWLYELAAKRISJ-QWRGUYRKSA-N |
| XLogP | 1.99 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|