About methyl 2-[(1S,2R)-2-methyl-1-oxo-1,3-dithiolan-2-yl]acetate
methyl 2-[(1S,2R)-2-methyl-1-oxo-1,3-dithiolan-2-yl]acetate (PubChem CID 131847045) has the molecular formula C7H12O3S2
and a molecular weight of 208.30 g/mol. Its IUPAC name is methyl 2-[(1S,2R)-2-methyl-1-oxo-1,3-dithiolan-2-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[(1S,2R)-2-methyl-1-oxo-1,3-dithiolan-2-yl]acetate |
| PubChem CID | 131847045 |
| Molecular Formula | C7H12O3S2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.02 |
| IUPAC Name | methyl 2-[(1S,2R)-2-methyl-1-oxo-1,3-dithiolan-2-yl]acetate |
| SMILES | COC(=O)C[C@]1(C)SCC[S@@]1=O |
| InChI | InChI=1S/C7H12O3S2/c1-7(5-6(8)10-2)11-3-4-12(7)9/h3-5H2,1-2H3/t7-,12+/m1/s1 |
| InChIKey | IDAKHGWODNJUGA-KRTXAFLBSA-N |
| XLogP | 0.76 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[(1S,2R)-2-methyl-1-oxo-1,3-dithiolan-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(1S,2R)-2-methyl-1-oxo-1,3-dithiolan-2-yl]acetate?
The IUPAC name of methyl 2-[(1S,2R)-2-methyl-1-oxo-1,3-dithiolan-2-yl]acetate (CID 131847045) is methyl 2-[(1S,2R)-2-methyl-1-oxo-1,3-dithiolan-2-yl]acetate.
What is the SMILES notation for methyl 2-[(1S,2R)-2-methyl-1-oxo-1,3-dithiolan-2-yl]acetate?
The canonical SMILES for methyl 2-[(1S,2R)-2-methyl-1-oxo-1,3-dithiolan-2-yl]acetate is COC(=O)C[C@]1(C)SCC[S@@]1=O.
What is the InChIKey of methyl 2-[(1S,2R)-2-methyl-1-oxo-1,3-dithiolan-2-yl]acetate?
The InChIKey is IDAKHGWODNJUGA-KRTXAFLBSA-N. The full InChI is InChI=1S/C7H12O3S2/c1-7(5-6(8)10-2)11-3-4-12(7)9/h3-5H2,1-2H3/t7-,12+/m1/s1.
What are the key properties of methyl 2-[(1S,2R)-2-methyl-1-oxo-1,3-dithiolan-2-yl]acetate?
methyl 2-[(1S,2R)-2-methyl-1-oxo-1,3-dithiolan-2-yl]acetate has a molecular weight of 208.30 g/mol, XLogP of 0.76, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(1S,2R)-2-methyl-1-oxo-1,3-dithiolan-2-yl]acetate is sourced from PubChem (CID 131847045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).