About 2-methyl-1-(2-methyl-1,3-dithian-2-yl)prop-2-en-1-ol
2-methyl-1-(2-methyl-1,3-dithian-2-yl)prop-2-en-1-ol (PubChem CID 131847055) has the molecular formula C9H16OS2
and a molecular weight of 204.36 g/mol. Its IUPAC name is 2-methyl-1-(2-methyl-1,3-dithian-2-yl)prop-2-en-1-ol.
Molecular Properties
| Compound Name | 2-methyl-1-(2-methyl-1,3-dithian-2-yl)prop-2-en-1-ol |
| PubChem CID | 131847055 |
| Molecular Formula | C9H16OS2 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 2-methyl-1-(2-methyl-1,3-dithian-2-yl)prop-2-en-1-ol |
| SMILES | C=C(C)C(O)C1(C)SCCCS1 |
| InChI | InChI=1S/C9H16OS2/c1-7(2)8(10)9(3)11-5-4-6-12-9/h8,10H,1,4-6H2,2-3H3 |
| InChIKey | CNMURZHFKCYPIG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1-(2-methyl-1,3-dithian-2-yl)prop-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-(2-methyl-1,3-dithian-2-yl)prop-2-en-1-ol?
The IUPAC name of 2-methyl-1-(2-methyl-1,3-dithian-2-yl)prop-2-en-1-ol (CID 131847055) is 2-methyl-1-(2-methyl-1,3-dithian-2-yl)prop-2-en-1-ol.
What is the SMILES notation for 2-methyl-1-(2-methyl-1,3-dithian-2-yl)prop-2-en-1-ol?
The canonical SMILES for 2-methyl-1-(2-methyl-1,3-dithian-2-yl)prop-2-en-1-ol is C=C(C)C(O)C1(C)SCCCS1.
What is the InChIKey of 2-methyl-1-(2-methyl-1,3-dithian-2-yl)prop-2-en-1-ol?
The InChIKey is CNMURZHFKCYPIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16OS2/c1-7(2)8(10)9(3)11-5-4-6-12-9/h8,10H,1,4-6H2,2-3H3.
What are the key properties of 2-methyl-1-(2-methyl-1,3-dithian-2-yl)prop-2-en-1-ol?
2-methyl-1-(2-methyl-1,3-dithian-2-yl)prop-2-en-1-ol has a molecular weight of 204.36 g/mol, XLogP of 2.51, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-(2-methyl-1,3-dithian-2-yl)prop-2-en-1-ol is sourced from PubChem (CID 131847055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).