C15H21NO — CID 13184752
2-(2,6-diethylphenyl)-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 13184752) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is 2-(2,6-diethylphenyl)-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-(2,6-diethylphenyl)-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 13184752 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 2-(2,6-diethylphenyl)-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | CCc1cccc(CC)c1C1=NC(C)(C)CO1 |
| InChI | InChI=1S/C15H21NO/c1-5-11-8-7-9-12(6-2)13(11)14-16-15(3,4)10-17-14/h7-9H,5-6,10H2,1-4H3 |
| InChIKey | NFCVSRHSKOFQNP-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |