About (2S,4R)-2-methyl-4-propyl-1,3-dioxolane
(2S,4R)-2-methyl-4-propyl-1,3-dioxolane (PubChem CID 131847771) has the molecular formula C7H14O2
and a molecular weight of 130.19 g/mol. Its IUPAC name is (2S,4R)-2-methyl-4-propyl-1,3-dioxolane.
Molecular Properties
| Compound Name | (2S,4R)-2-methyl-4-propyl-1,3-dioxolane |
| PubChem CID | 131847771 |
| Molecular Formula | C7H14O2 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | (2S,4R)-2-methyl-4-propyl-1,3-dioxolane |
| SMILES | CCC[C@@H]1CO[C@H](C)O1 |
| InChI | InChI=1S/C7H14O2/c1-3-4-7-5-8-6(2)9-7/h6-7H,3-5H2,1-2H3/t6-,7+/m0/s1 |
| InChIKey | GFGKEVLETNGWFW-NKWVEPMBSA-N |
| XLogP | 1.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S,4R)-2-methyl-4-propyl-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4R)-2-methyl-4-propyl-1,3-dioxolane?
The IUPAC name of (2S,4R)-2-methyl-4-propyl-1,3-dioxolane (CID 131847771) is (2S,4R)-2-methyl-4-propyl-1,3-dioxolane.
What is the SMILES notation for (2S,4R)-2-methyl-4-propyl-1,3-dioxolane?
The canonical SMILES for (2S,4R)-2-methyl-4-propyl-1,3-dioxolane is CCC[C@@H]1CO[C@H](C)O1.
What is the InChIKey of (2S,4R)-2-methyl-4-propyl-1,3-dioxolane?
The InChIKey is GFGKEVLETNGWFW-NKWVEPMBSA-N. The full InChI is InChI=1S/C7H14O2/c1-3-4-7-5-8-6(2)9-7/h6-7H,3-5H2,1-2H3/t6-,7+/m0/s1.
What are the key properties of (2S,4R)-2-methyl-4-propyl-1,3-dioxolane?
(2S,4R)-2-methyl-4-propyl-1,3-dioxolane has a molecular weight of 130.19 g/mol, XLogP of 1.55, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4R)-2-methyl-4-propyl-1,3-dioxolane is sourced from PubChem (CID 131847771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).