About CID 131847838
CID 131847838 (PubChem CID 131847838) has the molecular formula C8H9NNaO2
and a molecular weight of 174.16 g/mol.
Molecular Properties
| Compound Name | CID 131847838 |
| PubChem CID | 131847838 |
| Molecular Formula | C8H9NNaO2 |
| Molecular Weight | 174.16 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | — |
| SMILES | Cc1cccc(CC(=O)O)n1.[Na] |
| InChI | InChI=1S/C8H9NO2.Na/c1-6-3-2-4-7(9-6)5-8(10)11;/h2-4H,5H2,1H3,(H,10,11); |
| InChIKey | RBPZKFZSWXCFDJ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.16 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 131847838 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 131847838?
The IUPAC name of CID 131847838 (CID 131847838) is not available.
What is the SMILES notation for CID 131847838?
The canonical SMILES for CID 131847838 is Cc1cccc(CC(=O)O)n1.[Na].
What is the InChIKey of CID 131847838?
The InChIKey is RBPZKFZSWXCFDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2.Na/c1-6-3-2-4-7(9-6)5-8(10)11;/h2-4H,5H2,1H3,(H,10,11);.
What are the key properties of CID 131847838?
CID 131847838 has a molecular weight of 174.16 g/mol, XLogP of 0.64, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 131847838 is sourced from PubChem (CID 131847838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).