About 5,8-diethoxy-3,3-dimethyl-2H-cyclopenta[a]naphthalen-1-one
5,8-diethoxy-3,3-dimethyl-2H-cyclopenta[a]naphthalen-1-one (PubChem CID 13184849) has the molecular formula C19H22O3
and a molecular weight of 298.38 g/mol. Its IUPAC name is 5,8-diethoxy-3,3-dimethyl-2H-cyclopenta[a]naphthalen-1-one.
Molecular Properties
| Compound Name | 5,8-diethoxy-3,3-dimethyl-2H-cyclopenta[a]naphthalen-1-one |
| PubChem CID | 13184849 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 5,8-diethoxy-3,3-dimethyl-2H-cyclopenta[a]naphthalen-1-one |
| SMILES | CCOc1ccc2c(OCC)cc3c(c2c1)C(=O)CC3(C)C |
| InChI | InChI=1S/C19H22O3/c1-5-21-12-7-8-13-14(9-12)18-15(10-17(13)22-6-2)19(3,4)11-16(18)20/h7-10H,5-6,11H2,1-4H3 |
| InChIKey | RZLHEOBPXMWDSQ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,8-diethoxy-3,3-dimethyl-2H-cyclopenta[a]naphthalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,8-diethoxy-3,3-dimethyl-2H-cyclopenta[a]naphthalen-1-one?
The IUPAC name of 5,8-diethoxy-3,3-dimethyl-2H-cyclopenta[a]naphthalen-1-one (CID 13184849) is 5,8-diethoxy-3,3-dimethyl-2H-cyclopenta[a]naphthalen-1-one.
What is the SMILES notation for 5,8-diethoxy-3,3-dimethyl-2H-cyclopenta[a]naphthalen-1-one?
The canonical SMILES for 5,8-diethoxy-3,3-dimethyl-2H-cyclopenta[a]naphthalen-1-one is CCOc1ccc2c(OCC)cc3c(c2c1)C(=O)CC3(C)C.
What is the InChIKey of 5,8-diethoxy-3,3-dimethyl-2H-cyclopenta[a]naphthalen-1-one?
The InChIKey is RZLHEOBPXMWDSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22O3/c1-5-21-12-7-8-13-14(9-12)18-15(10-17(13)22-6-2)19(3,4)11-16(18)20/h7-10H,5-6,11H2,1-4H3.
What are the key properties of 5,8-diethoxy-3,3-dimethyl-2H-cyclopenta[a]naphthalen-1-one?
5,8-diethoxy-3,3-dimethyl-2H-cyclopenta[a]naphthalen-1-one has a molecular weight of 298.38 g/mol, XLogP of 4.50, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,8-diethoxy-3,3-dimethyl-2H-cyclopenta[a]naphthalen-1-one is sourced from PubChem (CID 13184849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).